C18H21NO5 — CID 71211771
(1R,11S,13R,15S)-13-methoxy-5,7,21-trioxa-19-azahexacyclo[11.7.1.02,10.04,8.011,15.015,19]henicosa-2,4(8),9-trien-12-ol (PubChem CID 71211771) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is (1R,11S,13R,15S)-13-methoxy-5,7,21-trioxa-19-azahexacyclo[11.7.1.02,10.04,8.011,15.015,19]henicosa-2,4(8),9-trien-12-ol.
| Compound Name | (1R,11S,13R,15S)-13-methoxy-5,7,21-trioxa-19-azahexacyclo[11.7.1.02,10.04,8.011,15.015,19]henicosa-2,4(8),9-trien-12-ol |
|---|---|
| PubChem CID | 71211771 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (1R,11S,13R,15S)-13-methoxy-5,7,21-trioxa-19-azahexacyclo[11.7.1.02,10.04,8.011,15.015,19]henicosa-2,4(8),9-trien-12-ol |
| SMILES | CO[C@]12C[C@]34CCCN3C[C@H](O1)c1cc3c(cc1[C@@H]4C2O)OCO3 |
| InChI | InChI=1S/C18H21NO5/c1-21-18-8-17-3-2-4-19(17)7-14(24-18)10-5-12-13(23-9-22-12)6-11(10)15(17)16(18)20/h5-6,14-16,20H,2-4,7-9H2,1H3/t14-,15+,16?,17-,18+/m0/s1 |
| InChIKey | KYTDBKDWDOVRLJ-VQTPCSAVSA-N |
| XLogP | 1.53 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |