C19H23NO6 — CID 23584538
[(2R,3S,4R,6R,12R)-3,4-dihydroxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),13,15(19)-trien-12-yl] acetate (PubChem CID 23584538) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is [(2R,3S,4R,6R,12R)-3,4-dihydroxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),13,15(19)-trien-12-yl] acetate.
| Compound Name | [(2R,3S,4R,6R,12R)-3,4-dihydroxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),13,15(19)-trien-12-yl] acetate |
|---|---|
| PubChem CID | 23584538 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | [(2R,3S,4R,6R,12R)-3,4-dihydroxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),13,15(19)-trien-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1CN2CCC[C@]23C[C@@H](O)[C@@H](O)[C@@H]3c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C19H23NO6/c1-10(21)26-16-8-20-4-2-3-19(20)7-13(22)18(23)17(19)12-6-15-14(5-11(12)16)24-9-25-15/h5-6,13,16-18,22-23H,2-4,7-9H2,1H3/t13-,16+,17+,18-,19-/m1/s1 |
| InChIKey | AGESOQKNSYJOGM-CAEUUNHDSA-N |
| XLogP | 1.08 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |