C16H18ClNO4 — CID 11120873
[(10aR,11R)-7,8,9,10,10a,11-hexahydro-[1,3]benzodioxolo[6,5-b]quinolizin-6-ium-11-yl] acetate chloride (PubChem CID 11120873) has the molecular formula C16H18ClNO4 and a molecular weight of 323.78 g/mol. Its IUPAC name is [(10aR,11R)-7,8,9,10,10a,11-hexahydro-[1,3]benzodioxolo[6,5-b]quinolizin-6-ium-11-yl] acetate chloride.
| Compound Name | [(10aR,11R)-7,8,9,10,10a,11-hexahydro-[1,3]benzodioxolo[6,5-b]quinolizin-6-ium-11-yl] acetate chloride |
|---|---|
| PubChem CID | 11120873 |
| Molecular Formula | C16H18ClNO4 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | [(10aR,11R)-7,8,9,10,10a,11-hexahydro-[1,3]benzodioxolo[6,5-b]quinolizin-6-ium-11-yl] acetate chloride |
| SMILES | CC(=O)O[C@@H]1c2cc3c(cc2C=[N+]2CCCC[C@H]12)OCO3.[Cl-] |
| InChI | InChI=1S/C16H18NO4.ClH/c1-10(18)21-16-12-7-15-14(19-9-20-15)6-11(12)8-17-5-3-2-4-13(16)17;/h6-8,13,16H,2-5,9H2,1H3;1H/q+1;/p-1/t13-,16-;/m1./s1 |
| InChIKey | FVOVAOMZMPKQSV-OALZAMAHSA-M |
| XLogP | -0.98 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|