C15H16O4 — CID 166439516
[(1R)-3-(1,3-benzodioxol-5-yl)cyclohex-2-en-1-yl] acetate (PubChem CID 166439516) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is [(1R)-3-(1,3-benzodioxol-5-yl)cyclohex-2-en-1-yl] acetate.
| Compound Name | [(1R)-3-(1,3-benzodioxol-5-yl)cyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 166439516 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | [(1R)-3-(1,3-benzodioxol-5-yl)cyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C(c2ccc3c(c2)OCO3)CCC1 |
| InChI | InChI=1S/C15H16O4/c1-10(16)19-13-4-2-3-11(7-13)12-5-6-14-15(8-12)18-9-17-14/h5-8,13H,2-4,9H2,1H3/t13-/m1/s1 |
| InChIKey | BDJANHWWPUUYKH-CYBMUJFWSA-N |
| XLogP | 2.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |