C11H8O5 — CID 56978420
4-(1,3-benzodioxol-5-yl)-2-hydroxy-2H-furan-5-one (PubChem CID 56978420) has the molecular formula C11H8O5 and a molecular weight of 220.18 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-hydroxy-2H-furan-5-one.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 56978420 |
| Molecular Formula | C11H8O5 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-hydroxy-2H-furan-5-one |
| SMILES | O=C1OC(O)C=C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H8O5/c12-10-4-7(11(13)16-10)6-1-2-8-9(3-6)15-5-14-8/h1-4,10,12H,5H2 |
| InChIKey | ZRNYRWXMPQIQDA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |