C19H18O4 — CID 59496794
[3-(1,3-benzodioxol-5-yl)-5-hydroxyphenyl]-cyclopentylmethanone (PubChem CID 59496794) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is [3-(1,3-benzodioxol-5-yl)-5-hydroxyphenyl]-cyclopentylmethanone.
| Compound Name | [3-(1,3-benzodioxol-5-yl)-5-hydroxyphenyl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 59496794 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | [3-(1,3-benzodioxol-5-yl)-5-hydroxyphenyl]-cyclopentylmethanone |
| SMILES | O=C(c1cc(O)cc(-c2ccc3c(c2)OCO3)c1)C1CCCC1 |
| InChI | InChI=1S/C19H18O4/c20-16-8-14(13-5-6-17-18(10-13)23-11-22-17)7-15(9-16)19(21)12-3-1-2-4-12/h5-10,12,20H,1-4,11H2 |
| InChIKey | XHTRYDCJYAMFHM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |