C15H16O4 — CID 82301465
(E)-3-(1,3-benzodioxol-5-yl)-3-cyclopentylprop-2-enoic acid (PubChem CID 82301465) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-3-cyclopentylprop-2-enoic acid.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-3-cyclopentylprop-2-enoic acid |
|---|---|
| PubChem CID | 82301465 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-3-cyclopentylprop-2-enoic acid |
| SMILES | O=C(O)/C=C(/c1ccc2c(c1)OCO2)C1CCCC1 |
| InChI | InChI=1S/C15H16O4/c16-15(17)8-12(10-3-1-2-4-10)11-5-6-13-14(7-11)19-9-18-13/h5-8,10H,1-4,9H2,(H,16,17)/b12-8+ |
| InChIKey | VJURNQUMEHFPEQ-XYOKQWHBSA-N |
| XLogP | 3.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|