C16H18O4 — CID 82306824
(E)-3-cyclobutyl-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoic acid (PubChem CID 82306824) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is (E)-3-cyclobutyl-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoic acid.
| Compound Name | (E)-3-cyclobutyl-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 82306824 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (E)-3-cyclobutyl-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C(/c1ccc2c(c1)OCCCO2)C1CCC1 |
| InChI | InChI=1S/C16H18O4/c17-16(18)10-13(11-3-1-4-11)12-5-6-14-15(9-12)20-8-2-7-19-14/h5-6,9-11H,1-4,7-8H2,(H,17,18)/b13-10+ |
| InChIKey | GURNTRAMTMEGEA-JLHYYAGUSA-N |
| XLogP | 3.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|