C23H29NO6Si — CID 134959165
(1R,11R,16S)-11-[tert-butyl(dimethyl)silyl]oxy-16-hydroxy-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,17-tetraene-14,19-dione (PubChem CID 134959165) has the molecular formula C23H29NO6Si and a molecular weight of 443.57 g/mol. Its IUPAC name is (1R,11R,16S)-11-[tert-butyl(dimethyl)silyl]oxy-16-hydroxy-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,17-tetraene-14,19-dione.
| Compound Name | (1R,11R,16S)-11-[tert-butyl(dimethyl)silyl]oxy-16-hydroxy-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,17-tetraene-14,19-dione |
|---|---|
| PubChem CID | 134959165 |
| Molecular Formula | C23H29NO6Si |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (1R,11R,16S)-11-[tert-butyl(dimethyl)silyl]oxy-16-hydroxy-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,17-tetraene-14,19-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CN2C(=O)C[C@]3(O)C=CC(=O)C[C@]23c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C23H29NO6Si/c1-21(2,3)31(4,5)30-19-12-24-20(26)11-22(27)7-6-14(25)10-23(22,24)16-9-18-17(8-15(16)19)28-13-29-18/h6-9,19,27H,10-13H2,1-5H3/t19-,22+,23+/m0/s1 |
| InChIKey | WFYQGJIJLNADAH-WWPVKYPJSA-N |
| XLogP | 3.18 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|