C19H26O6Si — CID 11463077
methyl (2R,3S)-3-(1,3-benzodioxol-5-yl)-2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]oxirane-2-carboxylate (PubChem CID 11463077) has the molecular formula C19H26O6Si and a molecular weight of 378.50 g/mol. Its IUPAC name is methyl (2R,3S)-3-(1,3-benzodioxol-5-yl)-2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]oxirane-2-carboxylate.
| Compound Name | methyl (2R,3S)-3-(1,3-benzodioxol-5-yl)-2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 11463077 |
| Molecular Formula | C19H26O6Si |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | methyl (2R,3S)-3-(1,3-benzodioxol-5-yl)-2-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]oxirane-2-carboxylate |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)[C@]1(C(=O)OC)O[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H26O6Si/c1-12(25-26(6,7)18(2,3)4)19(17(20)21-5)16(24-19)13-8-9-14-15(10-13)23-11-22-14/h8-10,16H,1,11H2,2-7H3/t16-,19-/m0/s1 |
| InChIKey | ZHCZWLSHJWHQTJ-LPHOPBHVSA-N |
| XLogP | 3.93 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|