C17H17NO6 — CID 25208285
(2R,3R,9S,10R)-2,9-dihydroxy-4-methyl-11,16,18-trioxa-4-azapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),7,13,15(19)-tetraen-12-one (PubChem CID 25208285) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is (2R,3R,9S,10R)-2,9-dihydroxy-4-methyl-11,16,18-trioxa-4-azapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),7,13,15(19)-tetraen-12-one.
| Compound Name | (2R,3R,9S,10R)-2,9-dihydroxy-4-methyl-11,16,18-trioxa-4-azapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),7,13,15(19)-tetraen-12-one |
|---|---|
| PubChem CID | 25208285 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (2R,3R,9S,10R)-2,9-dihydroxy-4-methyl-11,16,18-trioxa-4-azapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),7,13,15(19)-tetraen-12-one |
| SMILES | CN1CCC2=C[C@H](O)[C@H]3OC(=O)c4cc5c(cc4[C@@]3(O)[C@@H]21)OCO5 |
| InChI | InChI=1S/C17H17NO6/c1-18-3-2-8-4-11(19)15-17(21,14(8)18)10-6-13-12(22-7-23-13)5-9(10)16(20)24-15/h4-6,11,14-15,19,21H,2-3,7H2,1H3/t11-,14+,15+,17+/m0/s1 |
| InChIKey | SFXPHQQLLAZNSN-LDXOSZSPSA-N |
| XLogP | 0.15 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|