C17H10F3NO4 — CID 68599447
1'-(trifluoromethyl)spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one (PubChem CID 68599447) has the molecular formula C17H10F3NO4 and a molecular weight of 349.26 g/mol. Its IUPAC name is 1'-(trifluoromethyl)spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one.
| Compound Name | 1'-(trifluoromethyl)spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
|---|---|
| PubChem CID | 68599447 |
| Molecular Formula | C17H10F3NO4 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 1'-(trifluoromethyl)spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
| SMILES | O=C1N(C(F)(F)F)c2ccccc2C12COc1cc3c(cc12)OCO3 |
| InChI | InChI=1S/C17H10F3NO4/c18-17(19,20)21-11-4-2-1-3-9(11)16(15(21)22)7-23-12-6-14-13(5-10(12)16)24-8-25-14/h1-6H,7-8H2 |
| InChIKey | RHCVDADSZWPIHO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|