C33H27F3N2O5 — CID 46103044
[3-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]-2-methylphenyl] acetate (PubChem CID 46103044) has the molecular formula C33H27F3N2O5 and a molecular weight of 588.58 g/mol. Its IUPAC name is [3-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]-2-methylphenyl] acetate.
| Compound Name | [3-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 46103044 |
| Molecular Formula | C33H27F3N2O5 |
| Molecular Weight | 588.58 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | [3-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]-2-methylphenyl] acetate |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)c1cccc(OC(C)=O)c1C)C3c1ccc(-c2ccccc2C(F)(F)F)o1 |
| InChI | InChI=1S/C33H27F3N2O5/c1-18-21(8-6-10-27(18)42-19(2)39)32(40)38-16-15-22-24-17-20(41-3)11-12-26(24)37-30(22)31(38)29-14-13-28(43-29)23-7-4-5-9-25(23)33(34,35)36/h4-14,17,31,37H,15-16H2,1-3H3 |
| InChIKey | PSPJERCCINFLGE-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 84.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.58 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|