C28H29NO6 — CID 92773364
[3-[(1R)-6,7-dimethoxy-1-(4-methoxyphenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-2-methylphenyl] acetate (PubChem CID 92773364) has the molecular formula C28H29NO6 and a molecular weight of 475.54 g/mol. Its IUPAC name is [3-[(1R)-6,7-dimethoxy-1-(4-methoxyphenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-2-methylphenyl] acetate.
| Compound Name | [3-[(1R)-6,7-dimethoxy-1-(4-methoxyphenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 92773364 |
| Molecular Formula | C28H29NO6 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | [3-[(1R)-6,7-dimethoxy-1-(4-methoxyphenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-2-methylphenyl] acetate |
| SMILES | COc1ccc([C@@H]2c3cc(OC)c(OC)cc3CCN2C(=O)c2cccc(OC(C)=O)c2C)cc1 |
| InChI | InChI=1S/C28H29NO6/c1-17-22(7-6-8-24(17)35-18(2)30)28(31)29-14-13-20-15-25(33-4)26(34-5)16-23(20)27(29)19-9-11-21(32-3)12-10-19/h6-12,15-16,27H,13-14H2,1-5H3/t27-/m1/s1 |
| InChIKey | VCVDHIIVTDWIIR-HHHXNRCGSA-N |
| XLogP | 4.73 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|