C26H26N2OS2 — CID 25446018
1-[(1S)-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-4-thiophen-2-ylbutan-1-one (PubChem CID 25446018) has the molecular formula C26H26N2OS2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 1-[(1S)-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-[(1S)-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 25446018 |
| Molecular Formula | C26H26N2OS2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 1-[(1S)-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-4-thiophen-2-ylbutan-1-one |
| SMILES | CSc1ccc([C@H]2c3[nH]c4ccccc4c3CCN2C(=O)CCCc2cccs2)cc1 |
| InChI | InChI=1S/C26H26N2OS2/c1-30-19-13-11-18(12-14-19)26-25-22(21-8-2-3-9-23(21)27-25)15-16-28(26)24(29)10-4-6-20-7-5-17-31-20/h2-3,5,7-9,11-14,17,26-27H,4,6,10,15-16H2,1H3/t26-/m0/s1 |
| InChIKey | SYGCDPOPYMMADT-SANMLTNESA-N |
| XLogP | 6.45 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|