C28H25N3O3S — CID 46359948
4-[2-[1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]-1,4-benzoxazin-3-one (PubChem CID 46359948) has the molecular formula C28H25N3O3S and a molecular weight of 483.59 g/mol. Its IUPAC name is 4-[2-[1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-[2-[1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 46359948 |
| Molecular Formula | C28H25N3O3S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 4-[2-[1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]-1,4-benzoxazin-3-one |
| SMILES | CSc1ccc(C2c3[nH]c4ccccc4c3CCN2C(=O)CN2C(=O)COc3ccccc32)cc1 |
| InChI | InChI=1S/C28H25N3O3S/c1-35-19-12-10-18(11-13-19)28-27-21(20-6-2-3-7-22(20)29-27)14-15-30(28)25(32)16-31-23-8-4-5-9-24(23)34-17-26(31)33/h2-13,28-29H,14-17H2,1H3 |
| InChIKey | UCJFUJBNUNSUID-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|