C27H24N2O4 — CID 87685987
4-[(E)-3-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-enyl]benzene-1,2-diol (PubChem CID 87685987) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is 4-[(E)-3-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-enyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-3-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-enyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 87685987 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 4-[(E)-3-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-enyl]benzene-1,2-diol |
| SMILES | Oc1ccc(C/C=C/N2CCc3c([nH]c4ccccc34)C2c2ccc3c(c2)OCO3)cc1O |
| InChI | InChI=1S/C27H24N2O4/c30-22-9-7-17(14-23(22)31)4-3-12-29-13-11-20-19-5-1-2-6-21(19)28-26(20)27(29)18-8-10-24-25(15-18)33-16-32-24/h1-3,5-10,12,14-15,27-28,30-31H,4,11,13,16H2/b12-3+ |
| InChIKey | ZJOHMDSKRKGQSA-KGVSQERTSA-N |
| XLogP | 5.01 |
| TPSA | 77.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|