C25H25N3O4 — CID 126418465
(3S)-1-(1,3-benzodioxol-5-ylmethyl)-5-oxo-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]pyrrolidine-3-carboxamide (PubChem CID 126418465) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is (3S)-1-(1,3-benzodioxol-5-ylmethyl)-5-oxo-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(1,3-benzodioxol-5-ylmethyl)-5-oxo-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126418465 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (3S)-1-(1,3-benzodioxol-5-ylmethyl)-5-oxo-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]pyrrolidine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCc2c1[nH]c1ccccc21)[C@H]1CC(=O)N(Cc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C25H25N3O4/c29-23-11-16(13-28(23)12-15-8-9-21-22(10-15)32-14-31-21)25(30)27-20-7-3-5-18-17-4-1-2-6-19(17)26-24(18)20/h1-2,4,6,8-10,16,20,26H,3,5,7,11-14H2,(H,27,30)/t16-,20+/m0/s1 |
| InChIKey | QCPCYFLQYBYLOM-OXJNMPFZSA-N |
| XLogP | 3.44 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|