C23H24N2O2 — CID 75492025
3-(2,3-dihydro-1-benzofuran-5-yl)-N-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)propanamide (PubChem CID 75492025) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-5-yl)-N-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)propanamide.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-N-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)propanamide |
|---|---|
| PubChem CID | 75492025 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-N-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)propanamide |
| SMILES | O=C(CCc1ccc2c(c1)CCO2)NC1CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C23H24N2O2/c26-22(11-9-15-8-10-21-16(14-15)12-13-27-21)24-20-7-3-5-18-17-4-1-2-6-19(17)25-23(18)20/h1-2,4,6,8,10,14,20,25H,3,5,7,9,11-13H2,(H,24,26) |
| InChIKey | JWKJLNYUSQPFLS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|