C24H29N3O3S — CID 25354544
N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 25354544) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 25354544 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)C[C@H]2CCS(=O)(=O)C2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-27(2)19-9-7-18(8-10-19)21(22-15-25-23-6-4-3-5-20(22)23)14-26-24(28)13-17-11-12-31(29,30)16-17/h3-10,15,17,21,25H,11-14,16H2,1-2H3,(H,26,28)/t17-,21-/m1/s1 |
| InChIKey | FNCXOUUUQLDBEL-DYESRHJHSA-N |
| XLogP | 3.31 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|