C24H32N4O2S — CID 43062038
N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-methylpiperidine-1-sulfonamide (PubChem CID 43062038) has the molecular formula C24H32N4O2S and a molecular weight of 440.61 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-methylpiperidine-1-sulfonamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 43062038 |
| Molecular Formula | C24H32N4O2S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-methylpiperidine-1-sulfonamide |
| SMILES | CC1CCCN(S(=O)(=O)NCC(c2ccc(N(C)C)cc2)c2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C24H32N4O2S/c1-18-7-6-14-28(17-18)31(29,30)26-16-22(19-10-12-20(13-11-19)27(2)3)23-15-25-24-9-5-4-8-21(23)24/h4-5,8-13,15,18,22,25-26H,6-7,14,16-17H2,1-3H3 |
| InChIKey | KASMUMDNKJRUBK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|