C20H20BrN3O4 — CID 39972648
3-bromo-4-ethoxy-N'-[2-(1H-indol-3-yl)acetyl]-5-methoxybenzohydrazide (PubChem CID 39972648) has the molecular formula C20H20BrN3O4 and a molecular weight of 446.30 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-N'-[2-(1H-indol-3-yl)acetyl]-5-methoxybenzohydrazide.
| Compound Name | 3-bromo-4-ethoxy-N'-[2-(1H-indol-3-yl)acetyl]-5-methoxybenzohydrazide |
|---|---|
| PubChem CID | 39972648 |
| Molecular Formula | C20H20BrN3O4 |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 3-bromo-4-ethoxy-N'-[2-(1H-indol-3-yl)acetyl]-5-methoxybenzohydrazide |
| SMILES | CCOc1c(Br)cc(C(=O)NNC(=O)Cc2c[nH]c3ccccc23)cc1OC |
| InChI | InChI=1S/C20H20BrN3O4/c1-3-28-19-15(21)8-12(9-17(19)27-2)20(26)24-23-18(25)10-13-11-22-16-7-5-4-6-14(13)16/h4-9,11,22H,3,10H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | CNAXJQJLDNGAOD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|