C30H26ClNO7 — CID 19185086
3-[(2-oxochromene-3-carbonyl)amino]propyl (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate (PubChem CID 19185086) has the molecular formula C30H26ClNO7 and a molecular weight of 547.99 g/mol. Its IUPAC name is 3-[(2-oxochromene-3-carbonyl)amino]propyl (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate.
| Compound Name | 3-[(2-oxochromene-3-carbonyl)amino]propyl (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19185086 |
| Molecular Formula | C30H26ClNO7 |
| Molecular Weight | 547.99 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 3-[(2-oxochromene-3-carbonyl)amino]propyl (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCCCNC(=O)c2cc3ccccc3oc2=O)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H26ClNO7/c1-36-27-17-20(9-13-26(27)38-19-21-7-11-23(31)12-8-21)10-14-28(33)37-16-4-15-32-29(34)24-18-22-5-2-3-6-25(22)39-30(24)35/h2-3,5-14,17-18H,4,15-16,19H2,1H3,(H,32,34)/b14-10+ |
| InChIKey | JXBUBPPOKDLGLQ-GXDHUFHOSA-N |
| XLogP | 5.41 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.99 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|