C20H14BrNO6 — CID 19186326
(3-carbamoyl-2-oxochromen-7-yl) (E)-3-(3-bromo-4-methoxyphenyl)prop-2-enoate (PubChem CID 19186326) has the molecular formula C20H14BrNO6 and a molecular weight of 444.24 g/mol. Its IUPAC name is (3-carbamoyl-2-oxochromen-7-yl) (E)-3-(3-bromo-4-methoxyphenyl)prop-2-enoate.
| Compound Name | (3-carbamoyl-2-oxochromen-7-yl) (E)-3-(3-bromo-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19186326 |
| Molecular Formula | C20H14BrNO6 |
| Molecular Weight | 444.24 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | (3-carbamoyl-2-oxochromen-7-yl) (E)-3-(3-bromo-4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)Oc2ccc3cc(C(N)=O)c(=O)oc3c2)cc1Br |
| InChI | InChI=1S/C20H14BrNO6/c1-26-16-6-2-11(8-15(16)21)3-7-18(23)27-13-5-4-12-9-14(19(22)24)20(25)28-17(12)10-13/h2-10H,1H3,(H2,22,24)/b7-3+ |
| InChIKey | KCFMFWFGTTUAHB-XVNBXDOJSA-N |
| XLogP | 3.28 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|