C21H25FN2O6 — CID 59879196
N-[(2S)-1-[(1-fluoro-2-oxopentan-3-yl)amino]-3-methyl-1-oxobutan-2-yl]-7-methoxy-2-oxochromene-3-carboxamide (PubChem CID 59879196) has the molecular formula C21H25FN2O6 and a molecular weight of 420.44 g/mol. Its IUPAC name is N-[(2S)-1-[(1-fluoro-2-oxopentan-3-yl)amino]-3-methyl-1-oxobutan-2-yl]-7-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-[(2S)-1-[(1-fluoro-2-oxopentan-3-yl)amino]-3-methyl-1-oxobutan-2-yl]-7-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 59879196 |
| Molecular Formula | C21H25FN2O6 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-[(2S)-1-[(1-fluoro-2-oxopentan-3-yl)amino]-3-methyl-1-oxobutan-2-yl]-7-methoxy-2-oxochromene-3-carboxamide |
| SMILES | CCC(NC(=O)[C@@H](NC(=O)c1cc2ccc(OC)cc2oc1=O)C(C)C)C(=O)CF |
| InChI | InChI=1S/C21H25FN2O6/c1-5-15(16(25)10-22)23-20(27)18(11(2)3)24-19(26)14-8-12-6-7-13(29-4)9-17(12)30-21(14)28/h6-9,11,15,18H,5,10H2,1-4H3,(H,23,27)(H,24,26)/t15?,18-/m0/s1 |
| InChIKey | PUGKESGXGCVRBA-PKHIMPSTSA-N |
| XLogP | 1.99 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|