C21H19F2NO3 — CID 18225243
N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-methoxynaphthalene-2-carboxamide (PubChem CID 18225243) has the molecular formula C21H19F2NO3 and a molecular weight of 371.38 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 18225243 |
| Molecular Formula | C21H19F2NO3 |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H19F2NO3/c1-26-19-13-16-5-3-2-4-15(16)12-18(19)20(25)24-11-10-14-6-8-17(9-7-14)27-21(22)23/h2-9,12-13,21H,10-11H2,1H3,(H,24,25) |
| InChIKey | HKLKRIKTTYYJGC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |