C19H21F2NO3 — CID 18116815
N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-(2-methoxy-5-methylphenyl)acetamide (PubChem CID 18116815) has the molecular formula C19H21F2NO3 and a molecular weight of 349.38 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-(2-methoxy-5-methylphenyl)acetamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-(2-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18116815 |
| Molecular Formula | C19H21F2NO3 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-(2-methoxy-5-methylphenyl)acetamide |
| SMILES | COc1ccc(C)cc1CC(=O)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H21F2NO3/c1-13-3-8-17(24-2)15(11-13)12-18(23)22-10-9-14-4-6-16(7-5-14)25-19(20)21/h3-8,11,19H,9-10,12H2,1-2H3,(H,22,23) |
| InChIKey | FNFUAMRQOIHRNU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |