C17H20N2O5S — CID 108571361
N-[2-(benzenesulfonamido)ethyl]-3,5-dimethoxybenzamide (PubChem CID 108571361) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)ethyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(benzenesulfonamido)ethyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 108571361 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[2-(benzenesulfonamido)ethyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCCNS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H20N2O5S/c1-23-14-10-13(11-15(12-14)24-2)17(20)18-8-9-19-25(21,22)16-6-4-3-5-7-16/h3-7,10-12,19H,8-9H2,1-2H3,(H,18,20) |
| InChIKey | FSBZSATUNNTTEM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|