C19H23N3O4 — CID 5128444
N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-propan-2-ylfuran-2-carboxamide (PubChem CID 5128444) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-propan-2-ylfuran-2-carboxamide.
| Compound Name | N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-propan-2-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 5128444 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-propan-2-ylfuran-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)CNC(=O)CN(C(=O)c2ccco2)C(C)C)cc1 |
| InChI | InChI=1S/C19H23N3O4/c1-13(2)22(19(25)16-5-4-10-26-16)12-18(24)20-11-17(23)21-15-8-6-14(3)7-9-15/h4-10,13H,11-12H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | ADBDSTTYFCQRTP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |