C21H24N2O2 — CID 42762739
N-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-propan-2-ylfuran-2-carboxamide (PubChem CID 42762739) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-propan-2-ylfuran-2-carboxamide.
| Compound Name | N-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-propan-2-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 42762739 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-propan-2-ylfuran-2-carboxamide |
| SMILES | Cc1ccc(Cn2cccc2CN(C(=O)c2ccco2)C(C)C)cc1 |
| InChI | InChI=1S/C21H24N2O2/c1-16(2)23(21(24)20-7-5-13-25-20)15-19-6-4-12-22(19)14-18-10-8-17(3)9-11-18/h4-13,16H,14-15H2,1-3H3 |
| InChIKey | PDLXBHBHVFXXJX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |