C11H17NO3 — CID 61040244
N-(3-hydroxypropyl)-N-propan-2-ylfuran-2-carboxamide (PubChem CID 61040244) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-N-propan-2-ylfuran-2-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-N-propan-2-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 61040244 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | N-(3-hydroxypropyl)-N-propan-2-ylfuran-2-carboxamide |
| SMILES | CC(C)N(CCCO)C(=O)c1ccco1 |
| InChI | InChI=1S/C11H17NO3/c1-9(2)12(6-4-7-13)11(14)10-5-3-8-15-10/h3,5,8-9,13H,4,6-7H2,1-2H3 |
| InChIKey | IWAVXVWGDQKRKV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |