C19H18N4O5 — CID 71451934
5-[[2-[(4-methoxyphenyl)carbamoylamino]acetyl]amino]-1H-indole-2-carboxylic acid (PubChem CID 71451934) has the molecular formula C19H18N4O5 and a molecular weight of 382.38 g/mol. Its IUPAC name is 5-[[2-[(4-methoxyphenyl)carbamoylamino]acetyl]amino]-1H-indole-2-carboxylic acid.
| Compound Name | 5-[[2-[(4-methoxyphenyl)carbamoylamino]acetyl]amino]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 71451934 |
| Molecular Formula | C19H18N4O5 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 5-[[2-[(4-methoxyphenyl)carbamoylamino]acetyl]amino]-1H-indole-2-carboxylic acid |
| SMILES | COc1ccc(NC(=O)NCC(=O)Nc2ccc3[nH]c(C(=O)O)cc3c2)cc1 |
| InChI | InChI=1S/C19H18N4O5/c1-28-14-5-2-12(3-6-14)22-19(27)20-10-17(24)21-13-4-7-15-11(8-13)9-16(23-15)18(25)26/h2-9,23H,10H2,1H3,(H,21,24)(H,25,26)(H2,20,22,27) |
| InChIKey | BEVDCYWWWBUMGK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |