C19H16N2O4 — CID 155026003
5-[3-(4-methoxyphenyl)prop-2-enoylamino]-1H-indole-2-carboxylic acid (PubChem CID 155026003) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 5-[3-(4-methoxyphenyl)prop-2-enoylamino]-1H-indole-2-carboxylic acid.
| Compound Name | 5-[3-(4-methoxyphenyl)prop-2-enoylamino]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 155026003 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 5-[3-(4-methoxyphenyl)prop-2-enoylamino]-1H-indole-2-carboxylic acid |
| SMILES | COc1ccc(C=CC(=O)Nc2ccc3[nH]c(C(=O)O)cc3c2)cc1 |
| InChI | InChI=1S/C19H16N2O4/c1-25-15-6-2-12(3-7-15)4-9-18(22)20-14-5-8-16-13(10-14)11-17(21-16)19(23)24/h2-11,21H,1H3,(H,20,22)(H,23,24) |
| InChIKey | HGDFMLQDLRZVDW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|