C18H20ClN5O4 — CID 4623605
1-(4-chloro-2-methylphenyl)-3-[[2-[(4-methoxyphenyl)carbamoylamino]acetyl]amino]urea (PubChem CID 4623605) has the molecular formula C18H20ClN5O4 and a molecular weight of 405.84 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-3-[[2-[(4-methoxyphenyl)carbamoylamino]acetyl]amino]urea.
| Compound Name | 1-(4-chloro-2-methylphenyl)-3-[[2-[(4-methoxyphenyl)carbamoylamino]acetyl]amino]urea |
|---|---|
| PubChem CID | 4623605 |
| Molecular Formula | C18H20ClN5O4 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 1-(4-chloro-2-methylphenyl)-3-[[2-[(4-methoxyphenyl)carbamoylamino]acetyl]amino]urea |
| SMILES | COc1ccc(NC(=O)NCC(=O)NNC(=O)Nc2ccc(Cl)cc2C)cc1 |
| InChI | InChI=1S/C18H20ClN5O4/c1-11-9-12(19)3-8-15(11)22-18(27)24-23-16(25)10-20-17(26)21-13-4-6-14(28-2)7-5-13/h3-9H,10H2,1-2H3,(H,23,25)(H2,20,21,26)(H2,22,24,27) |
| InChIKey | OUKWFSVHGFUUNG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|