C19H32N6O — CID 134297482
1-[4-(butylamino)-6-methyl-1,3-diazinan-2-yl]-3-(1,2,3,4-tetrahydroisoquinolin-6-yl)urea (PubChem CID 134297482) has the molecular formula C19H32N6O and a molecular weight of 360.51 g/mol. Its IUPAC name is 1-[4-(butylamino)-6-methyl-1,3-diazinan-2-yl]-3-(1,2,3,4-tetrahydroisoquinolin-6-yl)urea.
| Compound Name | 1-[4-(butylamino)-6-methyl-1,3-diazinan-2-yl]-3-(1,2,3,4-tetrahydroisoquinolin-6-yl)urea |
|---|---|
| PubChem CID | 134297482 |
| Molecular Formula | C19H32N6O |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 1-[4-(butylamino)-6-methyl-1,3-diazinan-2-yl]-3-(1,2,3,4-tetrahydroisoquinolin-6-yl)urea |
| SMILES | CCCCNC1CC(C)NC(NC(=O)Nc2ccc3c(c2)CCNC3)N1 |
| InChI | InChI=1S/C19H32N6O/c1-3-4-8-21-17-10-13(2)22-18(24-17)25-19(26)23-16-6-5-15-12-20-9-7-14(15)11-16/h5-6,11,13,17-18,20-22,24H,3-4,7-10,12H2,1-2H3,(H2,23,25,26) |
| InChIKey | VPHRVQIOQZQQAS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|