C18H29F3N6O — CID 145147122
1-[4-[3-(dimethylamino)propylamino]-6-methyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 145147122) has the molecular formula C18H29F3N6O and a molecular weight of 402.47 g/mol. Its IUPAC name is 1-[4-[3-(dimethylamino)propylamino]-6-methyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[3-(dimethylamino)propylamino]-6-methyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 145147122 |
| Molecular Formula | C18H29F3N6O |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 1-[4-[3-(dimethylamino)propylamino]-6-methyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CC1CC(NCCCN(C)C)NC(NC(=O)Nc2ccc(C(F)(F)F)cc2)N1 |
| InChI | InChI=1S/C18H29F3N6O/c1-12-11-15(22-9-4-10-27(2)3)25-16(23-12)26-17(28)24-14-7-5-13(6-8-14)18(19,20)21/h5-8,12,15-16,22-23,25H,4,9-11H2,1-3H3,(H2,24,26,28) |
| InChIKey | KSGCAPODXOLBGF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|