C18H28ClF3N6O2 — CID 134297564
1-[3-chloro-4-(trifluoromethoxy)phenyl]-3-[4-[3-(dimethylamino)propylamino]-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 134297564) has the molecular formula C18H28ClF3N6O2 and a molecular weight of 452.91 g/mol. Its IUPAC name is 1-[3-chloro-4-(trifluoromethoxy)phenyl]-3-[4-[3-(dimethylamino)propylamino]-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-[3-chloro-4-(trifluoromethoxy)phenyl]-3-[4-[3-(dimethylamino)propylamino]-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 134297564 |
| Molecular Formula | C18H28ClF3N6O2 |
| Molecular Weight | 452.91 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 1-[3-chloro-4-(trifluoromethoxy)phenyl]-3-[4-[3-(dimethylamino)propylamino]-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCCN(C)C)NC(NC(=O)Nc2ccc(OC(F)(F)F)c(Cl)c2)N1 |
| InChI | InChI=1S/C18H28ClF3N6O2/c1-11-9-15(23-7-4-8-28(2)3)26-16(24-11)27-17(29)25-12-5-6-14(13(19)10-12)30-18(20,21)22/h5-6,10-11,15-16,23-24,26H,4,7-9H2,1-3H3,(H2,25,27,29) |
| InChIKey | QMKCOEQNYCRSFA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.91 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|