C15H24ClFN6O — CID 145147169
1-(3-chloro-4-fluorophenyl)-3-[4-methyl-6-[2-(methylamino)ethylamino]-1,3-diazinan-2-yl]urea (PubChem CID 145147169) has the molecular formula C15H24ClFN6O and a molecular weight of 358.85 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[4-methyl-6-[2-(methylamino)ethylamino]-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[4-methyl-6-[2-(methylamino)ethylamino]-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 145147169 |
| Molecular Formula | C15H24ClFN6O |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[4-methyl-6-[2-(methylamino)ethylamino]-1,3-diazinan-2-yl]urea |
| SMILES | CNCCNC1CC(C)NC(NC(=O)Nc2ccc(F)c(Cl)c2)N1 |
| InChI | InChI=1S/C15H24ClFN6O/c1-9-7-13(19-6-5-18-2)22-14(20-9)23-15(24)21-10-3-4-12(17)11(16)8-10/h3-4,8-9,13-14,18-20,22H,5-7H2,1-2H3,(H2,21,23,24) |
| InChIKey | UIZOZEBTWSZMNC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|