C18H36ClF3N6O — CID 145146966
1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-methyl-6-[2-(methylamino)ethylamino]-1,3-diazinan-2-yl]urea;ethane (PubChem CID 145146966) has the molecular formula C18H36ClF3N6O and a molecular weight of 444.97 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-methyl-6-[2-(methylamino)ethylamino]-1,3-diazinan-2-yl]urea;ethane.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-methyl-6-[2-(methylamino)ethylamino]-1,3-diazinan-2-yl]urea;ethane |
|---|---|
| PubChem CID | 145146966 |
| Molecular Formula | C18H36ClF3N6O |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-methyl-6-[2-(methylamino)ethylamino]-1,3-diazinan-2-yl]urea;ethane |
| SMILES | CC.CNCCNC1CC(C)NC(NC(=O)NC2CCC(Cl)C(C(F)(F)F)C2)N1 |
| InChI | InChI=1S/C16H30ClF3N6O.C2H6/c1-9-7-13(22-6-5-21-2)25-14(23-9)26-15(27)24-10-3-4-12(17)11(8-10)16(18,19)20;1-2/h9-14,21-23,25H,3-8H2,1-2H3,(H2,24,26,27);1-2H3 |
| InChIKey | VRXSBQRTIYKHOS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|