C19H38N6O — CID 153299869
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 153299869) has the molecular formula C19H38N6O and a molecular weight of 366.55 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 153299869 |
| Molecular Formula | C19H38N6O |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCCN)NC(NC(=O)NC2CCC3CCCCC3C2)N1 |
| InChI | InChI=1S/C19H38N6O/c1-13-11-17(21-10-4-9-20)24-18(22-13)25-19(26)23-16-8-7-14-5-2-3-6-15(14)12-16/h13-18,21-22,24H,2-12,20H2,1H3,(H2,23,25,26) |
| InChIKey | PCIKDZVNEUOXOL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|