C17H34N6O3 — CID 140900601
1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-yl)-3-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 140900601) has the molecular formula C17H34N6O3 and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-yl)-3-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-yl)-3-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900601 |
| Molecular Formula | C17H34N6O3 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-yl)-3-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCCN)NC(NC(=O)NC2CCC3OCCOC3C2)N1 |
| InChI | InChI=1S/C17H34N6O3/c1-11-9-15(19-6-2-5-18)22-16(20-11)23-17(24)21-12-3-4-13-14(10-12)26-8-7-25-13/h11-16,19-20,22H,2-10,18H2,1H3,(H2,21,23,24) |
| InChIKey | XIFDBMPKZKEHPB-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|