C20H42N6O — CID 142295452
1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-(3,4-diethylcyclohexyl)urea (PubChem CID 142295452) has the molecular formula C20H42N6O and a molecular weight of 382.60 g/mol. Its IUPAC name is 1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-(3,4-diethylcyclohexyl)urea.
| Compound Name | 1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-(3,4-diethylcyclohexyl)urea |
|---|---|
| PubChem CID | 142295452 |
| Molecular Formula | C20H42N6O |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.34 |
| IUPAC Name | 1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-(3,4-diethylcyclohexyl)urea |
| SMILES | CCC1CCC(NC(=O)NC2NC(C)CC(NCCCCN)N2)CC1CC |
| InChI | InChI=1S/C20H42N6O/c1-4-15-8-9-17(13-16(15)5-2)24-20(27)26-19-23-14(3)12-18(25-19)22-11-7-6-10-21/h14-19,22-23,25H,4-13,21H2,1-3H3,(H2,24,26,27) |
| InChIKey | SYZUAFNRHDHEKD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|