C19H38N6O — CID 140900629
1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-[4-[2-(dimethylamino)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 140900629) has the molecular formula C19H38N6O and a molecular weight of 366.55 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-[4-[2-(dimethylamino)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-[4-[2-(dimethylamino)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900629 |
| Molecular Formula | C19H38N6O |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-[4-[2-(dimethylamino)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCN(C)C)NC(NC(=O)NC2CCC3CCCC3C2)N1 |
| InChI | InChI=1S/C19H38N6O/c1-13-11-17(20-9-10-25(2)3)23-18(21-13)24-19(26)22-16-8-7-14-5-4-6-15(14)12-16/h13-18,20-21,23H,4-12H2,1-3H3,(H2,22,24,26) |
| InChIKey | IBXGRGHTSRTTLG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |