C19H37N5O3 — CID 149424836
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-(2,3-dihydroxypropylamino)-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 149424836) has the molecular formula C19H37N5O3 and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-(2,3-dihydroxypropylamino)-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-(2,3-dihydroxypropylamino)-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 149424836 |
| Molecular Formula | C19H37N5O3 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-(2,3-dihydroxypropylamino)-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCC(O)CO)NC(NC(=O)NC2CCC3CCCCC3C2)N1 |
| InChI | InChI=1S/C19H37N5O3/c1-12-8-17(20-10-16(26)11-25)23-18(21-12)24-19(27)22-15-7-6-13-4-2-3-5-14(13)9-15/h12-18,20-21,23,25-26H,2-11H2,1H3,(H2,22,24,27) |
| InChIKey | FVYJPUIAGCEFED-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 117.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |