C18H35N5O — CID 140900640
1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-[4-methyl-6-(propylamino)-1,3-diazinan-2-yl]urea (PubChem CID 140900640) has the molecular formula C18H35N5O and a molecular weight of 337.51 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-[4-methyl-6-(propylamino)-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-[4-methyl-6-(propylamino)-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900640 |
| Molecular Formula | C18H35N5O |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.28 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-[4-methyl-6-(propylamino)-1,3-diazinan-2-yl]urea |
| SMILES | CCCNC1CC(C)NC(NC(=O)NC2CCC3CCCC3C2)N1 |
| InChI | InChI=1S/C18H35N5O/c1-3-9-19-16-10-12(2)20-17(22-16)23-18(24)21-15-8-7-13-5-4-6-14(13)11-15/h12-17,19-20,22H,3-11H2,1-2H3,(H2,21,23,24) |
| InChIKey | APICCVYGSLKWPA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |