C17H35N7O — CID 147515462
1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-3-[4-(2-aminoethylamino)-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 147515462) has the molecular formula C17H35N7O and a molecular weight of 353.52 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-3-[4-(2-aminoethylamino)-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-3-[4-(2-aminoethylamino)-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 147515462 |
| Molecular Formula | C17H35N7O |
| Molecular Weight | 353.52 g/mol |
| Exact Mass | 353.29 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-3-[4-(2-aminoethylamino)-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCN)NC(NC(=O)NC2CCC3CCCCC3N2)N1 |
| InChI | InChI=1S/C17H35N7O/c1-11-10-15(19-9-8-18)22-16(20-11)24-17(25)23-14-7-6-12-4-2-3-5-13(12)21-14/h11-16,19-22H,2-10,18H2,1H3,(H2,23,24,25) |
| InChIKey | ZUKXMJYBIOBZAU-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.52 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |