C26H45N7O — CID 134297509
1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-(1-cyclooctyl-1,2,3,4-tetrahydroisoquinolin-6-yl)urea (PubChem CID 134297509) has the molecular formula C26H45N7O and a molecular weight of 471.69 g/mol. Its IUPAC name is 1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-(1-cyclooctyl-1,2,3,4-tetrahydroisoquinolin-6-yl)urea.
| Compound Name | 1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-(1-cyclooctyl-1,2,3,4-tetrahydroisoquinolin-6-yl)urea |
|---|---|
| PubChem CID | 134297509 |
| Molecular Formula | C26H45N7O |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.37 |
| IUPAC Name | 1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-(1-cyclooctyl-1,2,3,4-tetrahydroisoquinolin-6-yl)urea |
| SMILES | CC1CC(NCCCN)NC(NC(=O)Nc2ccc3c(c2)CCNC3C2CCCCCCC2)N1 |
| InChI | InChI=1S/C26H45N7O/c1-18-16-23(28-14-7-13-27)32-25(30-18)33-26(34)31-21-10-11-22-20(17-21)12-15-29-24(22)19-8-5-3-2-4-6-9-19/h10-11,17-19,23-25,28-30,32H,2-9,12-16,27H2,1H3,(H2,31,33,34) |
| InChIKey | SNYANVHQZPOAIU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|