C19H30N6O4 — CID 145147032
N-[3-[[2-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)-6-methyl-1,3-diazinan-4-yl]amino]propyl]acetamide (PubChem CID 145147032) has the molecular formula C19H30N6O4 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-[3-[[2-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)-6-methyl-1,3-diazinan-4-yl]amino]propyl]acetamide.
| Compound Name | N-[3-[[2-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)-6-methyl-1,3-diazinan-4-yl]amino]propyl]acetamide |
|---|---|
| PubChem CID | 145147032 |
| Molecular Formula | C19H30N6O4 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | N-[3-[[2-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoylamino)-6-methyl-1,3-diazinan-4-yl]amino]propyl]acetamide |
| SMILES | CC(=O)NCCCNC1CC(C)NC(NC(=O)Nc2ccc3c(c2)OCCO3)N1 |
| InChI | InChI=1S/C19H30N6O4/c1-12-10-17(21-7-3-6-20-13(2)26)24-18(22-12)25-19(27)23-14-4-5-15-16(11-14)29-9-8-28-15/h4-5,11-12,17-18,21-22,24H,3,6-10H2,1-2H3,(H,20,26)(H2,23,25,27) |
| InChIKey | GUEYAKFFZURSRT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|