C17H28N6O5S — CID 145147031
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[4-[2-(methanesulfonamido)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 145147031) has the molecular formula C17H28N6O5S and a molecular weight of 428.52 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[4-[2-(methanesulfonamido)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[4-[2-(methanesulfonamido)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 145147031 |
| Molecular Formula | C17H28N6O5S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[4-[2-(methanesulfonamido)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCNS(C)(=O)=O)NC(NC(=O)Nc2ccc3c(c2)OCCO3)N1 |
| InChI | InChI=1S/C17H28N6O5S/c1-11-9-15(18-5-6-19-29(2,25)26)22-16(20-11)23-17(24)21-12-3-4-13-14(10-12)28-8-7-27-13/h3-4,10-11,15-16,18-20,22H,5-9H2,1-2H3,(H2,21,23,24) |
| InChIKey | RXLGPBVVEKKJSN-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|