C20H30N6O — CID 134297433
1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-naphthalen-2-ylurea (PubChem CID 134297433) has the molecular formula C20H30N6O and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-naphthalen-2-ylurea.
| Compound Name | 1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-naphthalen-2-ylurea |
|---|---|
| PubChem CID | 134297433 |
| Molecular Formula | C20H30N6O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-naphthalen-2-ylurea |
| SMILES | CC1CC(NCCCCN)NC(NC(=O)Nc2ccc3ccccc3c2)N1 |
| InChI | InChI=1S/C20H30N6O/c1-14-12-18(22-11-5-4-10-21)25-19(23-14)26-20(27)24-17-9-8-15-6-2-3-7-16(15)13-17/h2-3,6-9,13-14,18-19,22-23,25H,4-5,10-12,21H2,1H3,(H2,24,26,27) |
| InChIKey | WLMFXQCCCMBYAV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|